C20H27N3O3 — CID 47997599
1-cyclooctyl-3-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]urea (PubChem CID 47997599) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-cyclooctyl-3-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]urea.
| Compound Name | 1-cyclooctyl-3-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 47997599 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-cyclooctyl-3-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]urea |
| SMILES | O=C(Nc1ccccc1CN1C(=O)CCC1=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H27N3O3/c24-18-12-13-19(25)23(18)14-15-8-6-7-11-17(15)22-20(26)21-16-9-4-2-1-3-5-10-16/h6-8,11,16H,1-5,9-10,12-14H2,(H2,21,22,26) |
| InChIKey | SCAPLKRWZKCOTD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|