C18H21N3O5 — CID 167791723
cis-(1R,3S)-3-[[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]carbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 167791723) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]carbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]carbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 167791723 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | cis-(1R,3S)-3-[[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]carbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(Nc1ccccc1CN1C(=O)CCC1=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C18H21N3O5/c22-15-7-8-16(23)21(15)10-12-3-1-2-4-14(12)20-18(26)19-13-6-5-11(9-13)17(24)25/h1-4,11,13H,5-10H2,(H,24,25)(H2,19,20,26)/t11-,13+/m1/s1 |
| InChIKey | UJSIKVATDVSNRO-YPMHNXCESA-N |
| XLogP | 1.71 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|