About 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide
2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide (PubChem CID 119752267) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide |
| PubChem CID | 119752267 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)Nc1ccccc1CN1C(=O)CCC1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-11(2)16(18)17(23)19-13-7-5-4-6-12(13)10-20-14(21)8-9-15(20)22/h4-7,11,16H,3,8-10,18H2,1-2H3,(H,19,23) |
| InChIKey | YARLBJPCXRGUOO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide?
The IUPAC name of 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide (CID 119752267) is 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide.
What is the SMILES notation for 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide?
The canonical SMILES for 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide is CCC(C)C(N)C(=O)Nc1ccccc1CN1C(=O)CCC1=O.
What is the InChIKey of 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide?
The InChIKey is YARLBJPCXRGUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-3-11(2)16(18)17(23)19-13-7-5-4-6-12(13)10-20-14(21)8-9-15(20)22/h4-7,11,16H,3,8-10,18H2,1-2H3,(H,19,23).
What are the key properties of 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide?
2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide has a molecular weight of 317.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide is sourced from PubChem (CID 119752267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).