C17H23N3O3 — CID 119752267
2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide (PubChem CID 119752267) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 119752267 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-amino-N-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)Nc1ccccc1CN1C(=O)CCC1=O |
| InChI | InChI=1S/C17H23N3O3/c1-3-11(2)16(18)17(23)19-13-7-5-4-6-12(13)10-20-14(21)8-9-15(20)22/h4-7,11,16H,3,8-10,18H2,1-2H3,(H,19,23) |
| InChIKey | YARLBJPCXRGUOO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|