C16H22N4O — CID 61179643
(2S,3S)-2-amino-3-methyl-N-[2-(pyrazol-1-ylmethyl)phenyl]pentanamide (PubChem CID 61179643) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-[2-(pyrazol-1-ylmethyl)phenyl]pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-[2-(pyrazol-1-ylmethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 61179643 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-[2-(pyrazol-1-ylmethyl)phenyl]pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C16H22N4O/c1-3-12(2)15(17)16(21)19-14-8-5-4-7-13(14)11-20-10-6-9-18-20/h4-10,12,15H,3,11,17H2,1-2H3,(H,19,21)/t12-,15-/m0/s1 |
| InChIKey | XETAOHCGCOCSSP-WFASDCNBSA-N |
| XLogP | 2.24 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |