C15H20N4O — CID 61178018
(2S,3S)-2-amino-3-methyl-N-(2-pyrazol-1-ylphenyl)pentanamide (PubChem CID 61178018) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-(2-pyrazol-1-ylphenyl)pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-(2-pyrazol-1-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 61178018 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-(2-pyrazol-1-ylphenyl)pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C15H20N4O/c1-3-11(2)14(16)15(20)18-12-7-4-5-8-13(12)19-10-6-9-17-19/h4-11,14H,3,16H2,1-2H3,(H,18,20)/t11-,14-/m0/s1 |
| InChIKey | WYMNJMGVPSDGFY-FZMZJTMJSA-N |
| XLogP | 2.18 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |