C9H9F2NO2 — CID 103513898
2,2-difluoro-N-[2-(hydroxymethyl)phenyl]acetamide (PubChem CID 103513898) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 103513898 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2,2-difluoro-N-[2-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1CO)C(F)F |
| InChI | InChI=1S/C9H9F2NO2/c10-8(11)9(14)12-7-4-2-1-3-6(7)5-13/h1-4,8,13H,5H2,(H,12,14) |
| InChIKey | XDTICXLBUOGQLV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |