C15H16FN5O — CID 75506392
1-(3-fluoro-4-pyridinyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea (PubChem CID 75506392) has the molecular formula C15H16FN5O and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 75506392 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
| SMILES | O=C(Nc1ccncc1F)NC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C15H16FN5O/c16-12-9-17-7-4-13(12)20-15(22)19-11-5-8-21(10-11)14-3-1-2-6-18-14/h1-4,6-7,9,11H,5,8,10H2,(H2,17,19,20,22) |
| InChIKey | ZBXQMBWTYJGXMP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |