C24H30N4O3 — CID 20867008
2-[4-(cyclopentylcarbamoyl)piperidin-1-yl]-N-(3-methoxyphenyl)pyridine-4-carboxamide (PubChem CID 20867008) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-(cyclopentylcarbamoyl)piperidin-1-yl]-N-(3-methoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-[4-(cyclopentylcarbamoyl)piperidin-1-yl]-N-(3-methoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 20867008 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[4-(cyclopentylcarbamoyl)piperidin-1-yl]-N-(3-methoxyphenyl)pyridine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccnc(N3CCC(C(=O)NC4CCCC4)CC3)c2)c1 |
| InChI | InChI=1S/C24H30N4O3/c1-31-21-8-4-7-20(16-21)27-24(30)18-9-12-25-22(15-18)28-13-10-17(11-14-28)23(29)26-19-5-2-3-6-19/h4,7-9,12,15-17,19H,2-3,5-6,10-11,13-14H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | DUGCEYBHVRPYSD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |