C27H30N4O3 — CID 46360651
2-[4-[(2-ethylphenyl)carbamoyl]piperidin-1-yl]-N-(2-methoxyphenyl)pyridine-4-carboxamide (PubChem CID 46360651) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[4-[(2-ethylphenyl)carbamoyl]piperidin-1-yl]-N-(2-methoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-[4-[(2-ethylphenyl)carbamoyl]piperidin-1-yl]-N-(2-methoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46360651 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-[4-[(2-ethylphenyl)carbamoyl]piperidin-1-yl]-N-(2-methoxyphenyl)pyridine-4-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C1CCN(c2cc(C(=O)Nc3ccccc3OC)ccn2)CC1 |
| InChI | InChI=1S/C27H30N4O3/c1-3-19-8-4-5-9-22(19)29-26(32)20-13-16-31(17-14-20)25-18-21(12-15-28-25)27(33)30-23-10-6-7-11-24(23)34-2/h4-12,15,18,20H,3,13-14,16-17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | QCIGLKCNPVVATP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |