C26H27FN4O3 — CID 46360822
2-[4-[(4-ethoxyphenyl)carbamoyl]piperidin-1-yl]-N-(2-fluorophenyl)pyridine-4-carboxamide (PubChem CID 46360822) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-[4-[(4-ethoxyphenyl)carbamoyl]piperidin-1-yl]-N-(2-fluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-[4-[(4-ethoxyphenyl)carbamoyl]piperidin-1-yl]-N-(2-fluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46360822 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-[4-[(4-ethoxyphenyl)carbamoyl]piperidin-1-yl]-N-(2-fluorophenyl)pyridine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CCN(c3cc(C(=O)Nc4ccccc4F)ccn3)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O3/c1-2-34-21-9-7-20(8-10-21)29-25(32)18-12-15-31(16-13-18)24-17-19(11-14-28-24)26(33)30-23-6-4-3-5-22(23)27/h3-11,14,17-18H,2,12-13,15-16H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | KINFLCWTKJISBL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |