C21H24ClN3O4 — CID 19794366
3-[4-(2-chlorophenyl)piperazin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 19794366) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 3-[4-(2-chlorophenyl)piperazin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 19794366 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]propyl N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)OCCCN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H24ClN3O4/c22-17-4-1-2-5-18(17)25-11-9-24(10-12-25)8-3-13-27-21(26)23-16-6-7-19-20(14-16)29-15-28-19/h1-2,4-7,14H,3,8-13,15H2,(H,23,26) |
| InChIKey | WLEAFSULXVFKAE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|