C22H26N2O4 — CID 17414500
N-(1,3-benzodioxol-5-yl)-1-(3-phenoxypropyl)piperidine-4-carboxamide (PubChem CID 17414500) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(3-phenoxypropyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(3-phenoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17414500 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(3-phenoxypropyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N2O4/c25-22(23-18-7-8-20-21(15-18)28-16-27-20)17-9-12-24(13-10-17)11-4-14-26-19-5-2-1-3-6-19/h1-3,5-8,15,17H,4,9-14,16H2,(H,23,25) |
| InChIKey | YPCODAXEZOKMEK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|