C27H33N5O3 — CID 69253429
[1-[4-[4-(2-benzyl-1,3-dioxol-4-yl)piperazin-1-yl]butyl]indol-2-yl]urea (PubChem CID 69253429) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is [1-[4-[4-(2-benzyl-1,3-dioxol-4-yl)piperazin-1-yl]butyl]indol-2-yl]urea.
| Compound Name | [1-[4-[4-(2-benzyl-1,3-dioxol-4-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
|---|---|
| PubChem CID | 69253429 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | [1-[4-[4-(2-benzyl-1,3-dioxol-4-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
| SMILES | NC(=O)Nc1cc2ccccc2n1CCCCN1CCN(C2=COC(Cc3ccccc3)O2)CC1 |
| InChI | InChI=1S/C27H33N5O3/c28-27(33)29-24-19-22-10-4-5-11-23(22)32(24)13-7-6-12-30-14-16-31(17-15-30)25-20-34-26(35-25)18-21-8-2-1-3-9-21/h1-5,8-11,19-20,26H,6-7,12-18H2,(H3,28,29,33) |
| InChIKey | ZYLULHNWZCLLRA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|