C14H14O4 — CID 66877108
1-(2-benzyl-1,3-dioxol-4-yl)cyclopropane-1-carboxylic acid (PubChem CID 66877108) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dioxol-4-yl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(2-benzyl-1,3-dioxol-4-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 66877108 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(2-benzyl-1,3-dioxol-4-yl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C2=COC(Cc3ccccc3)O2)CC1 |
| InChI | InChI=1S/C14H14O4/c15-13(16)14(6-7-14)11-9-17-12(18-11)8-10-4-2-1-3-5-10/h1-5,9,12H,6-8H2,(H,15,16) |
| InChIKey | AJEBEJONKPPICR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |