C12H11BrO3 — CID 87886557
1-(2-benzyl-1,3-dioxol-4-yl)-2-bromoethanone (PubChem CID 87886557) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-dioxol-4-yl)-2-bromoethanone.
| Compound Name | 1-(2-benzyl-1,3-dioxol-4-yl)-2-bromoethanone |
|---|---|
| PubChem CID | 87886557 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1-(2-benzyl-1,3-dioxol-4-yl)-2-bromoethanone |
| SMILES | O=C(CBr)C1=COC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C12H11BrO3/c13-7-10(14)11-8-15-12(16-11)6-9-4-2-1-3-5-9/h1-5,8,12H,6-7H2 |
| InChIKey | DGQZKQQLIBPHTL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|