About methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate
methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate (PubChem CID 66772804) has the molecular formula C18H23NO5
and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate |
| PubChem CID | 66772804 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate |
| SMILES | CCCC[C@@H](NC(=O)C1=COC(Cc2ccccc2)O1)C(=O)OC |
| InChI | InChI=1S/C18H23NO5/c1-3-4-10-14(18(21)22-2)19-17(20)15-12-23-16(24-15)11-13-8-6-5-7-9-13/h5-9,12,14,16H,3-4,10-11H2,1-2H3,(H,19,20)/t14-,16?/m1/s1 |
| InChIKey | KXBGYDIRWQTXQP-IURRXHLWSA-N |
| XLogP | 2.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate?
The IUPAC name of methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate (CID 66772804) is methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate.
What is the SMILES notation for methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate?
The canonical SMILES for methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate is CCCC[C@@H](NC(=O)C1=COC(Cc2ccccc2)O1)C(=O)OC.
What is the InChIKey of methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate?
The InChIKey is KXBGYDIRWQTXQP-IURRXHLWSA-N. The full InChI is InChI=1S/C18H23NO5/c1-3-4-10-14(18(21)22-2)19-17(20)15-12-23-16(24-15)11-13-8-6-5-7-9-13/h5-9,12,14,16H,3-4,10-11H2,1-2H3,(H,19,20)/t14-,16?/m1/s1.
What are the key properties of methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate?
methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate has a molecular weight of 333.38 g/mol, XLogP of 2.29, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(2-benzyl-1,3-dioxole-4-carbonyl)amino]hexanoate is sourced from PubChem (CID 66772804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).