C18H24N4O3 — CID 10807407
methyl 2-[(5-amino-1-benzylimidazole-4-carbonyl)amino]hexanoate (PubChem CID 10807407) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 2-[(5-amino-1-benzylimidazole-4-carbonyl)amino]hexanoate.
| Compound Name | methyl 2-[(5-amino-1-benzylimidazole-4-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 10807407 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 2-[(5-amino-1-benzylimidazole-4-carbonyl)amino]hexanoate |
| SMILES | CCCCC(NC(=O)c1ncn(Cc2ccccc2)c1N)C(=O)OC |
| InChI | InChI=1S/C18H24N4O3/c1-3-4-10-14(18(24)25-2)21-17(23)15-16(19)22(12-20-15)11-13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11,19H2,1-2H3,(H,21,23) |
| InChIKey | FUIDEHBQICEZBK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |