C21H19NO7 — CID 70130429
5-[3-(2-benzyl-1,3-dioxol-4-yl)-5-nitrophenyl]-5-oxopentanoic acid (PubChem CID 70130429) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 5-[3-(2-benzyl-1,3-dioxol-4-yl)-5-nitrophenyl]-5-oxopentanoic acid.
| Compound Name | 5-[3-(2-benzyl-1,3-dioxol-4-yl)-5-nitrophenyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70130429 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-[3-(2-benzyl-1,3-dioxol-4-yl)-5-nitrophenyl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)c1cc(C2=COC(Cc3ccccc3)O2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19NO7/c23-18(7-4-8-20(24)25)15-10-16(12-17(11-15)22(26)27)19-13-28-21(29-19)9-14-5-2-1-3-6-14/h1-3,5-6,10-13,21H,4,7-9H2,(H,24,25) |
| InChIKey | AEKOGUSQABMMET-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|