C14H14O5 — CID 69342043
ethyl 2-(2-benzyl-1,3-dioxol-4-yl)-2-oxoacetate (PubChem CID 69342043) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 2-(2-benzyl-1,3-dioxol-4-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(2-benzyl-1,3-dioxol-4-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 69342043 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl 2-(2-benzyl-1,3-dioxol-4-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1=COC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H14O5/c1-2-17-14(16)13(15)11-9-18-12(19-11)8-10-6-4-3-5-7-10/h3-7,9,12H,2,8H2,1H3 |
| InChIKey | BFBGAEZXTVAYMG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|