About ethyl 2-phenyliminobutanoate
ethyl 2-phenyliminobutanoate (PubChem CID 158237119) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is ethyl 2-phenyliminobutanoate.
Molecular Properties
| Compound Name | ethyl 2-phenyliminobutanoate |
| PubChem CID | 158237119 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethyl 2-phenyliminobutanoate |
| SMILES | CCOC(=O)/C(CC)=N/c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-3-11(12(14)15-4-2)13-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3/b13-11+ |
| InChIKey | WKMRONXXWJYOFO-ACCUITESSA-N |
| XLogP | 2.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-phenyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenyliminobutanoate?
The IUPAC name of ethyl 2-phenyliminobutanoate (CID 158237119) is ethyl 2-phenyliminobutanoate.
What is the SMILES notation for ethyl 2-phenyliminobutanoate?
The canonical SMILES for ethyl 2-phenyliminobutanoate is CCOC(=O)/C(CC)=N/c1ccccc1.
What is the InChIKey of ethyl 2-phenyliminobutanoate?
The InChIKey is WKMRONXXWJYOFO-ACCUITESSA-N. The full InChI is InChI=1S/C12H15NO2/c1-3-11(12(14)15-4-2)13-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3/b13-11+.
What are the key properties of ethyl 2-phenyliminobutanoate?
ethyl 2-phenyliminobutanoate has a molecular weight of 205.26 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenyliminobutanoate is sourced from PubChem (CID 158237119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).