C22H24N2O2 — CID 134921737
ethyl 3-tert-butylimino-2-(C,N-diphenylcarbonimidoyl)prop-2-enoate (PubChem CID 134921737) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 3-tert-butylimino-2-(C,N-diphenylcarbonimidoyl)prop-2-enoate.
| Compound Name | ethyl 3-tert-butylimino-2-(C,N-diphenylcarbonimidoyl)prop-2-enoate |
|---|---|
| PubChem CID | 134921737 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl 3-tert-butylimino-2-(C,N-diphenylcarbonimidoyl)prop-2-enoate |
| SMILES | CCOC(=O)C(=C=NC(C)(C)C)/C(=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-5-26-21(25)19(16-23-22(2,3)4)20(17-12-8-6-9-13-17)24-18-14-10-7-11-15-18/h6-15H,5H2,1-4H3/b24-20- |
| InChIKey | GCQBMHBXLHOLFH-GFMRDNFCSA-N |
| XLogP | 4.77 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|