About diethyl oxalate;N-phenylaniline
diethyl oxalate;N-phenylaniline (PubChem CID 174415380) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is diethyl oxalate;N-phenylaniline.
Molecular Properties
| Compound Name | diethyl oxalate;N-phenylaniline |
| PubChem CID | 174415380 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | diethyl oxalate;N-phenylaniline |
| SMILES | CCOC(=O)C(=O)OCC.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C6H10O4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-5(7)6(8)10-4-2/h1-10,13H;3-4H2,1-2H3 |
| InChIKey | NKIRZHHTHZDUSL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl oxalate;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl oxalate;N-phenylaniline?
The IUPAC name of diethyl oxalate;N-phenylaniline (CID 174415380) is diethyl oxalate;N-phenylaniline.
What is the SMILES notation for diethyl oxalate;N-phenylaniline?
The canonical SMILES for diethyl oxalate;N-phenylaniline is CCOC(=O)C(=O)OCC.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of diethyl oxalate;N-phenylaniline?
The InChIKey is NKIRZHHTHZDUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C6H10O4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-5(7)6(8)10-4-2/h1-10,13H;3-4H2,1-2H3.
What are the key properties of diethyl oxalate;N-phenylaniline?
diethyl oxalate;N-phenylaniline has a molecular weight of 315.37 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl oxalate;N-phenylaniline is sourced from PubChem (CID 174415380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).