C16H22N4O2 — CID 144539371
ethane;ethyl 2-amino-4-anilino-6-methylpyrimidine-5-carboxylate (PubChem CID 144539371) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is ethane;ethyl 2-amino-4-anilino-6-methylpyrimidine-5-carboxylate.
| Compound Name | ethane;ethyl 2-amino-4-anilino-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144539371 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethane;ethyl 2-amino-4-anilino-6-methylpyrimidine-5-carboxylate |
| SMILES | CC.CCOC(=O)c1c(C)nc(N)nc1Nc1ccccc1 |
| InChI | InChI=1S/C14H16N4O2.C2H6/c1-3-20-13(19)11-9(2)16-14(15)18-12(11)17-10-7-5-4-6-8-10;1-2/h4-8H,3H2,1-2H3,(H3,15,16,17,18);1-2H3 |
| InChIKey | CLTOVVRKXDCWRF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |