C20H18BrN3O2 — CID 101042049
ethyl 4-bromo-6-(4-methylanilino)-2-phenylpyrimidine-5-carboxylate (PubChem CID 101042049) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is ethyl 4-bromo-6-(4-methylanilino)-2-phenylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-bromo-6-(4-methylanilino)-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 101042049 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | ethyl 4-bromo-6-(4-methylanilino)-2-phenylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(Br)nc(-c2ccccc2)nc1Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H18BrN3O2/c1-3-26-20(25)16-17(21)23-18(14-7-5-4-6-8-14)24-19(16)22-15-11-9-13(2)10-12-15/h4-12H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | ZGKQDLUEJZDMKR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |