C16H19N3O3 — CID 54851451
ethyl 2-amino-4-methyl-6-(1-phenoxyethyl)pyrimidine-5-carboxylate (PubChem CID 54851451) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl 2-amino-4-methyl-6-(1-phenoxyethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-amino-4-methyl-6-(1-phenoxyethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 54851451 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl 2-amino-4-methyl-6-(1-phenoxyethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(N)nc1C(C)Oc1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-21-15(20)13-10(2)18-16(17)19-14(13)11(3)22-12-8-6-5-7-9-12/h5-9,11H,4H2,1-3H3,(H2,17,18,19) |
| InChIKey | BXGQIUNHTLCGGW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |