C20H25NO5 — CID 71227511
ethyl 2-[4-(2-benzyl-1,3-dioxole-4-carbonyl)piperidin-1-yl]acetate (PubChem CID 71227511) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is ethyl 2-[4-(2-benzyl-1,3-dioxole-4-carbonyl)piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(2-benzyl-1,3-dioxole-4-carbonyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 71227511 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | ethyl 2-[4-(2-benzyl-1,3-dioxole-4-carbonyl)piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(C(=O)C2=COC(Cc3ccccc3)O2)CC1 |
| InChI | InChI=1S/C20H25NO5/c1-2-24-18(22)13-21-10-8-16(9-11-21)20(23)17-14-25-19(26-17)12-15-6-4-3-5-7-15/h3-7,14,16,19H,2,8-13H2,1H3 |
| InChIKey | HJRMHVNNQRWRIA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |