C16H21NO5 — CID 71236046
ethyl 2-[4-(3,4-dihydroxybenzoyl)piperidin-1-yl]acetate (PubChem CID 71236046) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 2-[4-(3,4-dihydroxybenzoyl)piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-(3,4-dihydroxybenzoyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 71236046 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 2-[4-(3,4-dihydroxybenzoyl)piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(C(=O)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C16H21NO5/c1-2-22-15(20)10-17-7-5-11(6-8-17)16(21)12-3-4-13(18)14(19)9-12/h3-4,9,11,18-19H,2,5-8,10H2,1H3 |
| InChIKey | LPLPZWBVJISFBH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|