C19H15BrO4 — CID 70155298
3-(2-benzyl-1,3-dioxol-4-yl)-1-(5-bromo-2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 70155298) has the molecular formula C19H15BrO4 and a molecular weight of 387.23 g/mol. Its IUPAC name is 3-(2-benzyl-1,3-dioxol-4-yl)-1-(5-bromo-2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2-benzyl-1,3-dioxol-4-yl)-1-(5-bromo-2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 70155298 |
| Molecular Formula | C19H15BrO4 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 3-(2-benzyl-1,3-dioxol-4-yl)-1-(5-bromo-2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C=CC1=COC(Cc2ccccc2)O1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C19H15BrO4/c20-14-6-8-17(21)16(11-14)18(22)9-7-15-12-23-19(24-15)10-13-4-2-1-3-5-13/h1-9,11-12,19,21H,10H2 |
| InChIKey | SNTZSQJKIVPUER-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|