About (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate
(3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate (PubChem CID 7786463) has the molecular formula C15H13BrO3
and a molecular weight of 321.17 g/mol. Its IUPAC name is (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate.
Molecular Properties
| Compound Name | (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate |
| PubChem CID | 7786463 |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate |
| SMILES | Cc1cccc(COC(=O)c2cc(Br)ccc2O)c1 |
| InChI | InChI=1S/C15H13BrO3/c1-10-3-2-4-11(7-10)9-19-15(18)13-8-12(16)5-6-14(13)17/h2-8,17H,9H2,1H3 |
| InChIKey | UGFNWDRRNOFKAF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate?
The IUPAC name of (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate (CID 7786463) is (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate.
What is the SMILES notation for (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate?
The canonical SMILES for (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate is Cc1cccc(COC(=O)c2cc(Br)ccc2O)c1.
What is the InChIKey of (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate?
The InChIKey is UGFNWDRRNOFKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrO3/c1-10-3-2-4-11(7-10)9-19-15(18)13-8-12(16)5-6-14(13)17/h2-8,17H,9H2,1H3.
What are the key properties of (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate?
(3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate has a molecular weight of 321.17 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 5-bromo-2-hydroxybenzoate is sourced from PubChem (CID 7786463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).