About (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate
(3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate (PubChem CID 91506796) has the molecular formula C23H30O3
and a molecular weight of 354.49 g/mol. Its IUPAC name is (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate.
Molecular Properties
| Compound Name | (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate |
| PubChem CID | 91506796 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate |
| SMILES | CCCCCC(C)(C)c1ccc(O)c(C(=O)OCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C23H30O3/c1-5-6-7-13-23(3,4)19-11-12-21(24)20(15-19)22(25)26-16-18-10-8-9-17(2)14-18/h8-12,14-15,24H,5-7,13,16H2,1-4H3 |
| InChIKey | PPMMDTSOJPXEQK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate?
The IUPAC name of (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate (CID 91506796) is (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate.
What is the SMILES notation for (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate?
The canonical SMILES for (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate is CCCCCC(C)(C)c1ccc(O)c(C(=O)OCc2cccc(C)c2)c1.
What is the InChIKey of (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate?
The InChIKey is PPMMDTSOJPXEQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O3/c1-5-6-7-13-23(3,4)19-11-12-21(24)20(15-19)22(25)26-16-18-10-8-9-17(2)14-18/h8-12,14-15,24H,5-7,13,16H2,1-4H3.
What are the key properties of (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate?
(3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate has a molecular weight of 354.49 g/mol, XLogP of 5.92, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methyl 2-hydroxy-5-(2-methylheptan-2-yl)benzoate is sourced from PubChem (CID 91506796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).