C56H84NiO4S2 — CID 87330010
bis(2-[2-hydroxy-5-(2-methylheptan-2-yl)phenyl]sulfanyl-4-(2-methylheptan-2-yl)phenol);nickel (PubChem CID 87330010) has the molecular formula C56H84NiO4S2 and a molecular weight of 944.11 g/mol. Its IUPAC name is bis(2-[2-hydroxy-5-(2-methylheptan-2-yl)phenyl]sulfanyl-4-(2-methylheptan-2-yl)phenol);nickel.
| Compound Name | bis(2-[2-hydroxy-5-(2-methylheptan-2-yl)phenyl]sulfanyl-4-(2-methylheptan-2-yl)phenol);nickel |
|---|---|
| PubChem CID | 87330010 |
| Molecular Formula | C56H84NiO4S2 |
| Molecular Weight | 944.11 g/mol |
| Exact Mass | 942.52 |
| IUPAC Name | bis(2-[2-hydroxy-5-(2-methylheptan-2-yl)phenyl]sulfanyl-4-(2-methylheptan-2-yl)phenol);nickel |
| SMILES | CCCCCC(C)(C)c1ccc(O)c(Sc2cc(C(C)(C)CCCCC)ccc2O)c1.CCCCCC(C)(C)c1ccc(O)c(Sc2cc(C(C)(C)CCCCC)ccc2O)c1.[Ni] |
| InChI | InChI=1S/2C28H42O2S.Ni/c2*1-7-9-11-17-27(3,4)21-13-15-23(29)25(19-21)31-26-20-22(14-16-24(26)30)28(5,6)18-12-10-8-2;/h2*13-16,19-20,29-30H,7-12,17-18H2,1-6H3; |
| InChIKey | AQIFKLAHFNMPKS-UHFFFAOYSA-N |
| XLogP | 17.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.11 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|