C32H40N4O5 — CID 42725326
N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide (PubChem CID 42725326) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42725326 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | N-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]ethyl]cyclohexanecarboxamide |
| SMILES | COc1ccccc1/C=C/CN(CCN1CCN(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)CC1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C32H40N4O5/c1-41-30-12-6-5-8-27(30)11-7-19-35(32(38)28-9-3-2-4-10-28)25-22-33-20-23-34(24-21-33)31(37)18-15-26-13-16-29(17-14-26)36(39)40/h5-8,11-18,28H,2-4,9-10,19-25H2,1H3/b11-7+,18-15+ |
| InChIKey | LGIWZDDCNXCXBT-JVAARVQTSA-N |
| XLogP | 4.88 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|