C32H53N3O3 — CID 4288845
N-[2-(4-decanoylpiperazin-1-yl)ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]-3,3-dimethylbutanamide (PubChem CID 4288845) has the molecular formula C32H53N3O3 and a molecular weight of 527.79 g/mol. Its IUPAC name is N-[2-(4-decanoylpiperazin-1-yl)ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(4-decanoylpiperazin-1-yl)ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 4288845 |
| Molecular Formula | C32H53N3O3 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.41 |
| IUPAC Name | N-[2-(4-decanoylpiperazin-1-yl)ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]-3,3-dimethylbutanamide |
| SMILES | CCCCCCCCCC(=O)N1CCN(CCN(CC=Cc2ccccc2OC)C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H53N3O3/c1-6-7-8-9-10-11-12-19-30(36)35-25-22-33(23-26-35)21-24-34(31(37)27-32(2,3)4)20-15-17-28-16-13-14-18-29(28)38-5/h13-18H,6-12,19-27H2,1-5H3 |
| InChIKey | KASGXFJRFSREOM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|