C28H39N3O4S — CID 3568708
N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]hexanamide (PubChem CID 3568708) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]hexanamide.
| Compound Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 3568708 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-N-[3-(2-methoxyphenyl)prop-2-enyl]hexanamide |
| SMILES | CCCCCC(=O)N(CC=Cc1ccccc1OC)CCN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H39N3O4S/c1-3-4-6-17-28(32)30(18-11-13-25-12-9-10-16-27(25)35-2)22-19-29-20-23-31(24-21-29)36(33,34)26-14-7-5-8-15-26/h5,7-16H,3-4,6,17-24H2,1-2H3 |
| InChIKey | HQUPEJJQJSQAFH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|