C28H37FN4O3 — CID 42710364
N-butyl-4-[2-[(4-fluorobenzoyl)-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide (PubChem CID 42710364) has the molecular formula C28H37FN4O3 and a molecular weight of 496.63 g/mol. Its IUPAC name is N-butyl-4-[2-[(4-fluorobenzoyl)-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide.
| Compound Name | N-butyl-4-[2-[(4-fluorobenzoyl)-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42710364 |
| Molecular Formula | C28H37FN4O3 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-butyl-4-[2-[(4-fluorobenzoyl)-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCN(CCN(C/C=C/c2ccccc2OC)C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H37FN4O3/c1-3-4-15-30-28(35)33-21-18-31(19-22-33)17-20-32(27(34)24-11-13-25(29)14-12-24)16-7-9-23-8-5-6-10-26(23)36-2/h5-14H,3-4,15-22H2,1-2H3,(H,30,35)/b9-7+ |
| InChIKey | IKHSXMYBRCCKPX-VQHVLOKHSA-N |
| XLogP | 4.12 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|