C35H42ClN3O3 — CID 3984910
3-chloro-N-[3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]benzamide (PubChem CID 3984910) has the molecular formula C35H42ClN3O3 and a molecular weight of 588.19 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 3984910 |
| Molecular Formula | C35H42ClN3O3 |
| Molecular Weight | 588.19 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | 3-chloro-N-[3-(2-methoxyphenyl)prop-2-enyl]-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(CCN(CC=Cc3ccccc3OC)C(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C35H42ClN3O3/c1-3-4-5-10-28-16-18-30(19-17-28)34(40)39-25-22-37(23-26-39)21-24-38(35(41)31-12-8-14-32(36)27-31)20-9-13-29-11-6-7-15-33(29)42-2/h6-9,11-19,27H,3-5,10,20-26H2,1-2H3 |
| InChIKey | AYTGTUKLXUBTGG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.19 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|