C31H44N4O3 — CID 6178697
N-(4-ethylphenyl)-4-[2-[hexanoyl-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide (PubChem CID 6178697) has the molecular formula C31H44N4O3 and a molecular weight of 520.72 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[2-[hexanoyl-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[2-[hexanoyl-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 6178697 |
| Molecular Formula | C31H44N4O3 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | N-(4-ethylphenyl)-4-[2-[hexanoyl-[(E)-3-(2-methoxyphenyl)prop-2-enyl]amino]ethyl]piperazine-1-carboxamide |
| SMILES | CCCCCC(=O)N(C/C=C/c1ccccc1OC)CCN1CCN(C(=O)Nc2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C31H44N4O3/c1-4-6-7-14-30(36)34(19-10-12-27-11-8-9-13-29(27)38-3)23-20-33-21-24-35(25-22-33)31(37)32-28-17-15-26(5-2)16-18-28/h8-13,15-18H,4-7,14,19-25H2,1-3H3,(H,32,37)/b12-10+ |
| InChIKey | ZRJCMGCYQZWRAG-ZRDIBKRKSA-N |
| XLogP | 5.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|