C19H31N3O3 — CID 141019589
1-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol (PubChem CID 141019589) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol.
| Compound Name | 1-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol |
|---|---|
| PubChem CID | 141019589 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-[3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol |
| SMILES | COc1cccc(N2CCN(CCCN3C(O)CCCC3O)CC2)c1 |
| InChI | InChI=1S/C19H31N3O3/c1-25-17-6-2-5-16(15-17)21-13-11-20(12-14-21)9-4-10-22-18(23)7-3-8-19(22)24/h2,5-6,15,18-19,23-24H,3-4,7-14H2,1H3 |
| InChIKey | IFGIDJRLNBSSQQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |