C25H35ClF4N4O3 — CID 87832863
3-(cyclobutylamino)-3-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione;hydrochloride (PubChem CID 87832863) has the molecular formula C25H35ClF4N4O3 and a molecular weight of 551.03 g/mol. Its IUPAC name is 3-(cyclobutylamino)-3-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione;hydrochloride.
| Compound Name | 3-(cyclobutylamino)-3-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 87832863 |
| Molecular Formula | C25H35ClF4N4O3 |
| Molecular Weight | 551.03 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 3-(cyclobutylamino)-3-methyl-1-[3-[4-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]piperazin-1-yl]propyl]pyrrolidine-2,5-dione;hydrochloride |
| SMILES | CC1(NC2CCC2)CC(=O)N(CCCN2CCN(c3ccccc3OCC(F)(F)C(F)F)CC2)C1=O.Cl |
| InChI | InChI=1S/C25H34F4N4O3.ClH/c1-24(30-18-6-4-7-18)16-21(34)33(23(24)35)11-5-10-31-12-14-32(15-13-31)19-8-2-3-9-20(19)36-17-25(28,29)22(26)27;/h2-3,8-9,18,22,30H,4-7,10-17H2,1H3;1H |
| InChIKey | DKINWAUIQIZOOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.03 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|