C28H40ClN3O3 — CID 11670583
12-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-12-azatricyclo[4.4.3.01,6]tridec-3-ene-11,13-dione;hydrochloride (PubChem CID 11670583) has the molecular formula C28H40ClN3O3 and a molecular weight of 502.10 g/mol. Its IUPAC name is 12-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-12-azatricyclo[4.4.3.01,6]tridec-3-ene-11,13-dione;hydrochloride.
| Compound Name | 12-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-12-azatricyclo[4.4.3.01,6]tridec-3-ene-11,13-dione;hydrochloride |
|---|---|
| PubChem CID | 11670583 |
| Molecular Formula | C28H40ClN3O3 |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | 12-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-12-azatricyclo[4.4.3.01,6]tridec-3-ene-11,13-dione;hydrochloride |
| SMILES | CC(C)Oc1ccccc1N1CCN(CCCN2C(=O)C34CC=CCC3(CCCC4)C2=O)CC1.Cl |
| InChI | InChI=1S/C28H39N3O3.ClH/c1-22(2)34-24-11-4-3-10-23(24)30-20-18-29(19-21-30)16-9-17-31-25(32)27-12-5-6-13-28(27,26(31)33)15-8-7-14-27;/h3-6,10-11,22H,7-9,12-21H2,1-2H3;1H |
| InChIKey | HGRFOJFUNXBQBA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|