C21H31N3O4 — CID 10249759
1-[3-[4-(2-hydroxy-6-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione (PubChem CID 10249759) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[3-[4-(2-hydroxy-6-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione.
| Compound Name | 1-[3-[4-(2-hydroxy-6-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 10249759 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-[3-[4-(2-hydroxy-6-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione |
| SMILES | CC(C)Oc1cccc(O)c1N1CCN(CCCN2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-16(2)28-18-7-3-6-17(25)21(18)23-14-12-22(13-15-23)10-5-11-24-19(26)8-4-9-20(24)27/h3,6-7,16,25H,4-5,8-15H2,1-2H3 |
| InChIKey | CNWOAXFZNHXAQE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|