C21H29N3O4 — CID 10047950
1-[3-oxo-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione (PubChem CID 10047950) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[3-oxo-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione.
| Compound Name | 1-[3-oxo-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 10047950 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[3-oxo-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-dione |
| SMILES | CC(C)Oc1ccccc1N1CCN(C(=O)CCN2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-16(2)28-18-7-4-3-6-17(18)22-12-14-23(15-13-22)19(25)10-11-24-20(26)8-5-9-21(24)27/h3-4,6-7,16H,5,8-15H2,1-2H3 |
| InChIKey | NMKLXQGKMQFMOP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|