C22H30ClN3O3 — CID 11604156
1-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione;hydrochloride (PubChem CID 11604156) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is 1-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 1-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 11604156 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione;hydrochloride |
| SMILES | CC(C)Oc1ccccc1N1CCN(CC#CCN2C(=O)CCCC2=O)CC1.Cl |
| InChI | InChI=1S/C22H29N3O3.ClH/c1-18(2)28-20-9-4-3-8-19(20)24-16-14-23(15-17-24)12-5-6-13-25-21(26)10-7-11-22(25)27;/h3-4,8-9,18H,7,10-17H2,1-2H3;1H |
| InChIKey | ZCVVXHXEQITAQH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|