C21H27N3O3 — CID 11582211
1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione (PubChem CID 11582211) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione.
| Compound Name | 1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 11582211 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]but-2-ynyl]piperidine-2,6-dione |
| SMILES | CCOc1ccccc1N1CCN(CC#CCN2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-27-19-9-4-3-8-18(19)23-16-14-22(15-17-23)12-5-6-13-24-20(25)10-7-11-21(24)26/h3-4,8-9H,2,7,10-17H2,1H3 |
| InChIKey | NBLQYIZHJQNIEM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|