C28H40N4O5 — CID 59144729
3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-9,9-dimethyl-7-propyl-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone (PubChem CID 59144729) has the molecular formula C28H40N4O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is 3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-9,9-dimethyl-7-propyl-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone.
| Compound Name | 3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-9,9-dimethyl-7-propyl-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone |
|---|---|
| PubChem CID | 59144729 |
| Molecular Formula | C28H40N4O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-9,9-dimethyl-7-propyl-3,7-diazabicyclo[3.3.1]nonane-2,4,6,8-tetrone |
| SMILES | CCCN1C(=O)C2C(=O)N(CCCCN3CCN(c4ccccc4OCC)CC3)C(=O)C(C1=O)C2(C)C |
| InChI | InChI=1S/C28H40N4O5/c1-5-13-31-24(33)22-26(35)32(27(36)23(25(31)34)28(22,3)4)15-10-9-14-29-16-18-30(19-17-29)20-11-7-8-12-21(20)37-6-2/h7-8,11-12,22-23H,5-6,9-10,13-19H2,1-4H3 |
| InChIKey | UBIWTXPWCBWXJY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|