C19H29N3O2S — CID 57185140
5-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-4-methyl-1,3-thiazolidin-2-one (PubChem CID 57185140) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 5-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-4-methyl-1,3-thiazolidin-2-one.
| Compound Name | 5-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-4-methyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 57185140 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 5-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-4-methyl-1,3-thiazolidin-2-one |
| SMILES | CCOc1ccccc1N1CCN(CCCC2SC(=O)NC2C)CC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-3-24-17-8-5-4-7-16(17)22-13-11-21(12-14-22)10-6-9-18-15(2)20-19(23)25-18/h4-5,7-8,15,18H,3,6,9-14H2,1-2H3,(H,20,23) |
| InChIKey | DFBNBLGXMIBTAW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|