C28H36N4O6 — CID 118050342
(5E)-3-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 118050342) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is (5E)-3-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118050342 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (5E)-3-[3-[4-(2-ethoxyphenyl)piperazin-1-yl]propyl]-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1ccccc1N1CCN(CCCN2C(=O)N/C(=C/c3cc(OC)c(OC)c(OC)c3)C2=O)CC1 |
| InChI | InChI=1S/C28H36N4O6/c1-5-38-23-10-7-6-9-22(23)31-15-13-30(14-16-31)11-8-12-32-27(33)21(29-28(32)34)17-20-18-24(35-2)26(37-4)25(19-20)36-3/h6-7,9-10,17-19H,5,8,11-16H2,1-4H3,(H,29,34)/b21-17+ |
| InChIKey | HNBPCTBRVXYJPK-HEHNFIMWSA-N |
| XLogP | 3.22 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|