C26H33N5O4 — CID 70686183
(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 70686183) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70686183 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-3-[2-hydroxy-3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | COc1ccccc1N1CCN(CC(O)CN2C(=O)N/C(=C\c3ccc(N(C)C)cc3)C2=O)CC1 |
| InChI | InChI=1S/C26H33N5O4/c1-28(2)20-10-8-19(9-11-20)16-22-25(33)31(26(34)27-22)18-21(32)17-29-12-14-30(15-13-29)23-6-4-5-7-24(23)35-3/h4-11,16,21,32H,12-15,17-18H2,1-3H3,(H,27,34)/b22-16- |
| InChIKey | LNMISJNHLOEAAR-JWGURIENSA-N |
| XLogP | 1.84 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|