C18H26Cl2N4O4 — CID 71508207
(5Z)-3-(2-hydroxy-3-piperazin-1-ylpropyl)-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;dihydrochloride (PubChem CID 71508207) has the molecular formula C18H26Cl2N4O4 and a molecular weight of 433.34 g/mol. Its IUPAC name is (5Z)-3-(2-hydroxy-3-piperazin-1-ylpropyl)-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;dihydrochloride.
| Compound Name | (5Z)-3-(2-hydroxy-3-piperazin-1-ylpropyl)-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 71508207 |
| Molecular Formula | C18H26Cl2N4O4 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (5Z)-3-(2-hydroxy-3-piperazin-1-ylpropyl)-5-[(4-methoxyphenyl)methylidene]imidazolidine-2,4-dione;dihydrochloride |
| SMILES | COc1ccc(/C=C2\NC(=O)N(CC(O)CN3CCNCC3)C2=O)cc1.Cl.Cl |
| InChI | InChI=1S/C18H24N4O4.2ClH/c1-26-15-4-2-13(3-5-15)10-16-17(24)22(18(25)20-16)12-14(23)11-21-8-6-19-7-9-21;;/h2-5,10,14,19,23H,6-9,11-12H2,1H3,(H,20,25);2*1H/b16-10-;; |
| InChIKey | KFHNARQBEMMJRD-FLPKAINGSA-N |
| XLogP | 0.70 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|