C19H32N2O2 — CID 110181232
1-[4-(2-methoxyphenyl)piperazin-1-yl]octan-2-ol (PubChem CID 110181232) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]octan-2-ol.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]octan-2-ol |
|---|---|
| PubChem CID | 110181232 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]octan-2-ol |
| SMILES | CCCCCCC(O)CN1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C19H32N2O2/c1-3-4-5-6-9-17(22)16-20-12-14-21(15-13-20)18-10-7-8-11-19(18)23-2/h7-8,10-11,17,22H,3-6,9,12-16H2,1-2H3 |
| InChIKey | JLCXHZGWRJYZOV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|